| Name |
2-[3-(3-chlorophenyl)-2,4-dioxo-1H,2H,3H,4H-thieno[3,2-d]pyrimidin-1-yl]-N-(3,4-dimethoxyphenyl)acetamide
|
| Molecular Formula |
C22H20ClN3O5S
|
| Molecular Weight |
473.9
|
| Smiles |
COc1ccc(NC(=O)CN2C(=O)N(c3cccc(Cl)c3)C(=O)C3SC=CC32)cc1OC
|
COc1ccc(NC(=O)CN2C(=O)N(c3cccc(Cl)c3)C(=O)C3SC=CC32)cc1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.