| Name |
N-(3-{2-methylpyrazolo[1,5-a]pyrimidin-6-yl}propyl)cyclobutanecarboxamide
|
| Molecular Formula |
C15H20N4O
|
| Molecular Weight |
272.35
|
| Smiles |
Cc1cc2ncc(CCCNC(=O)C3CCC3)cn2n1
|
Cc1cc2ncc(CCCNC(=O)C3CCC3)cn2n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.