| Name |
2-cyano-N-(1-methoxypropan-2-yl)-3-{2-phenylimidazo[1,2-a]pyridin-3-yl}prop-2-enamide
|
| Molecular Formula |
C21H20N4O2
|
| Molecular Weight |
360.4
|
| Smiles |
COCC(C)NC(=O)C(C#N)=Cc1c(-c2ccccc2)nc2ccccn12
|
COCC(C)NC(=O)C(C#N)=Cc1c(-c2ccccc2)nc2ccccn12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.