| Name |
10-(4-Methoxyphenyl)-1-methyl-4a,6,7,8,9,11a-hexahydropurino[7,8-a][1,3]diazepine-2,4-dione
|
| Molecular Formula |
C17H21N5O3
|
| Molecular Weight |
343.4
|
| Smiles |
COc1ccc(N2CCCCN3C2=NC2C3C(=O)NC(=O)N2C)cc1
|
COc1ccc(N2CCCCN3C2=NC2C3C(=O)NC(=O)N2C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.