| Name |
4-methyl-6-(2-prop-2-enoxyphenyl)-2-prop-2-enyl-8,9a-dihydro-7H-purino[7,8-a]imidazol-9-ium-1,3-dione
|
| Molecular Formula |
C20H22N5O3+
|
| Molecular Weight |
380.4
|
| Smiles |
C=CCOc1ccccc1N1CC[N+]2=C1N=C1C2C(=O)N(CC=C)C(=O)N1C
|
C=CCOc1ccccc1N1CC[N+]2=C1N=C1C2C(=O)N(CC=C)C(=O)N1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.