| Name |
10,16-Dihydroxy-6,6,19,19-tetramethyl-15-(3-methylbut-2-enyl)-5,13,18-trioxapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1(22),3(12),4(9),7,10,14,16,20-octaen-2-one
|
| Molecular Formula |
C28H28O6
|
| Molecular Weight |
460.5
|
| Smiles |
CC(C)=CCc1c(O)c2c(c3c(=O)c4c5c(c(O)cc4oc13)C=CC(C)(C)O5)C=CC(C)(C)O2
|
CC(C)=CCc1c(O)c2c(c3c(=O)c4c5c(c(O)cc4oc13)C=CC(C)(C)O5)C=CC(C)(C)O2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.