| Name | 2-(4,6-dimethylpyrimidin-2-yl)-6-sulfanylidene-7,7a-dihydro-1H-pyrazolo[3,4-d]pyrimidin-4-one | 
                        
                        
                        
                    
                 
                
                
                    
                        
                        
                            | Molecular Formula | C11H12N6OS | 
                        
                        
                            | Molecular Weight | 276.32 | 
                        
                        
                            | Smiles | Cc1cc(C)nc(N2C=C3C(=O)NC(=S)NC3N2)n1 | 
                        
                        
                    
                 
                
                
                
                
                
                
                
                    
                        Cc1cc(C)nc(N2C=C3C(=O)NC(=S)NC3N2)n1
                    
                 
                
                
                The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.