| Name |
(3R)-3,6-Dihydroxy-1-methyl-5-oxo-3,5-dihydro-2H-indol-1-ium
|
| Molecular Formula |
C9H10NO3+
|
| Molecular Weight |
180.18
|
| Smiles |
C[N+]1=C2C=C(O)C(=O)C=C2C(O)C1
|
C[N+]1=C2C=C(O)C(=O)C=C2C(O)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.