| Name |
4-(4H-1,2,4-triazol-4-yl)aniline dihydrochloride
|
| Molecular Formula |
C8H10Cl2N4
|
| Molecular Weight |
233.09
|
| Smiles |
Cl.Cl.Nc1ccc(-n2cnnc2)cc1
|
Cl.Cl.Nc1ccc(-n2cnnc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.