| Name |
6-(4-ethylphenyl)-4,7,8-trimethyl-2-(3-oxobutan-2-yl)-9aH-purino[7,8-a]imidazol-9-ium-1,3-dione
|
| Molecular Formula |
C22H26N5O3+
|
| Molecular Weight |
408.5
|
| Smiles |
CCc1ccc(-n2c(C)c(C)[n+]3c2N=C2C3C(=O)N(C(C)C(C)=O)C(=O)N2C)cc1
|
CCc1ccc(-n2c(C)c(C)[n+]3c2N=C2C3C(=O)N(C(C)C(C)=O)C(=O)N2C)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.