| Name |
Methyl 5-(3-methyl-2,3-dihydrobenzo[b][1,4]dioxine-2-carbonyl)-4,5,6,7-tetrahydrothieno[3,2-c]pyridine-4-carboxylate
|
| Molecular Formula |
C19H19NO5S
|
| Molecular Weight |
373.4
|
| Smiles |
COC(=O)C1c2ccsc2CCN1C(=O)C1Oc2ccccc2OC1C
|
COC(=O)C1c2ccsc2CCN1C(=O)C1Oc2ccccc2OC1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.