| Name |
1-(2,6-Difluorophenyl)-3-(5-(methylsulfonyl)-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)urea
|
| Molecular Formula |
C14H14F2N4O3S2
|
| Molecular Weight |
388.4
|
| Smiles |
CS(=O)(=O)N1CCc2nc(NC(=O)Nc3c(F)cccc3F)sc2C1
|
CS(=O)(=O)N1CCc2nc(NC(=O)Nc3c(F)cccc3F)sc2C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.