| Name |
6-(1H-1,2,4-triazol-1-yl)-N-(1H-1,2,4-triazol-5-yl)pyridazine-3-carboxamide
|
| Molecular Formula |
C9H7N9O
|
| Molecular Weight |
257.21
|
| Smiles |
O=C(Nc1ncn[nH]1)c1ccc(-n2cncn2)nn1
|
O=C(Nc1ncn[nH]1)c1ccc(-n2cncn2)nn1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.