| Name |
1,2:4,5-Bis-O-(1,2-dihydroxy-1,2-ethanediyl)-D-glucitol
|
| Molecular Formula |
C10H18O10
|
| Molecular Weight |
298.24
|
| Smiles |
OCC1OC(O)C(O)OC1C(O)C1COC(O)C(O)O1
|
OCC1OC(O)C(O)OC1C(O)C1COC(O)C(O)O1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.