| Name |
[(2S,4R)-4-(4-Acetamido-2-oxopyrimidin-1(2H)-yl)-1,3-dioxolan-2-yl]methyl benzoate
|
| Molecular Formula |
C17H17N3O6
|
| Molecular Weight |
359.3
|
| Smiles |
CC(=O)Nc1ccn(C2COC(COC(=O)c3ccccc3)O2)c(=O)n1
|
CC(=O)Nc1ccn(C2COC(COC(=O)c3ccccc3)O2)c(=O)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.