| Name |
3-{3-[4-(methylsulfonyl)piperazino]-3-oxopropyl}-4H-pyrido[2,1-c][1,2,4]triazin-4-one
|
| Molecular Formula |
C15H19N5O4S
|
| Molecular Weight |
365.4
|
| Smiles |
CS(=O)(=O)N1CCN(C(=O)CCc2nnc3ccccn3c2=O)CC1
|
CS(=O)(=O)N1CCN(C(=O)CCc2nnc3ccccn3c2=O)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.