| Name |
Methyl 3-(4,7,8-trimethyl-1,3-dioxo-6-phenyl-4a,9a-dihydropurino[7,8-a]imidazol-2-yl)propanoate
|
| Molecular Formula |
C20H23N5O4
|
| Molecular Weight |
397.4
|
| Smiles |
COC(=O)CCN1C(=O)C2C(N=C3N(c4ccccc4)C(C)=C(C)N32)N(C)C1=O
|
COC(=O)CCN1C(=O)C2C(N=C3N(c4ccccc4)C(C)=C(C)N32)N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.