| Name |
6-cyano-N-{2-methyl-5H,6H,7H,8H-imidazo[1,2-a]pyridin-6-yl}pyridine-3-sulfonamide
|
| Molecular Formula |
C14H15N5O2S
|
| Molecular Weight |
317.37
|
| Smiles |
Cc1cn2c(n1)CCC(NS(=O)(=O)c1ccc(C#N)nc1)C2
|
Cc1cn2c(n1)CCC(NS(=O)(=O)c1ccc(C#N)nc1)C2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.