| Name |
1-{Thieno[3,2-b]thiophene-2-carbonyl}piperazine hydrochloride
|
| Molecular Formula |
C11H13ClN2OS2
|
| Molecular Weight |
288.8
|
| Smiles |
Cl.O=C(c1cc2sccc2s1)N1CCNCC1
|
Cl.O=C(c1cc2sccc2s1)N1CCNCC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.