| Name |
N-(benzo[d][1,3]dioxol-5-ylmethyl)-2-(4-((4-(furan-2-yl)thiazol-2-yl)methyl)piperazin-1-yl)acetamide oxalate
|
| Molecular Formula |
C24H26N4O8S
|
| Molecular Weight |
530.6
|
| Smiles |
O=C(CN1CCN(Cc2nc(-c3ccco3)cs2)CC1)NCc1ccc2c(c1)OCO2.O=C(O)C(=O)O
|
O=C(CN1CCN(Cc2nc(-c3ccco3)cs2)CC1)NCc1ccc2c(c1)OCO2.O=C(O)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.