| Name |
Triphenyl(3,7,11-trimethyl-2,4,6,10-dodecatetraen-1-yl)phosphonium
|
| Molecular Formula |
C33H38P+
|
| Molecular Weight |
465.6
|
| Smiles |
CC(C)=CCCC(C)=CC=CC(C)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1
|
CC(C)=CCCC(C)=CC=CC(C)=CC[P+](c1ccccc1)(c1ccccc1)c1ccccc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.