| Name |
4-Phenyl-4,5,6,7-tetrahydro-3H-imidazo[4,5-c]pyridine dihydrochloride
|
| Molecular Formula |
C12H15Cl2N3
|
| Molecular Weight |
272.17
|
| Smiles |
Cl.Cl.c1ccc(C2NCCc3[nH]cnc32)cc1
|
Cl.Cl.c1ccc(C2NCCc3[nH]cnc32)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.