| Name |
2-(4-vinylbenzyl)-7,8,9,10-tetrahydro-[1,2,4]triazino[4,5-b]indazol-1(2H)-one
|
| Molecular Formula |
C18H18N4O
|
| Molecular Weight |
306.4
|
| Smiles |
C=Cc1ccc(Cn2ncn3nc4c(c3c2=O)CCCC4)cc1
|
C=Cc1ccc(Cn2ncn3nc4c(c3c2=O)CCCC4)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.