| Name |
1,4-Dioxane;(2Z)-2-[(2-methoxyphenyl)methylidene]-8-(pyridin-3-ylmethyl)-7,9-dihydrofuro[2,3-f][1,3]benzoxazin-3-one
|
| Molecular Formula |
C28H28N2O6
|
| Molecular Weight |
488.5
|
| Smiles |
C1COCCO1.COc1ccccc1C=C1Oc2c(ccc3c2CN(Cc2cccnc2)CO3)C1=O
|
C1COCCO1.COc1ccccc1C=C1Oc2c(ccc3c2CN(Cc2cccnc2)CO3)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.