| Name |
3,4-Di-O-benzyl DL-threo-Droxidopa-13C2,15N Hydrochloride
|
| Molecular Formula |
C23H24ClNO5
|
| Molecular Weight |
432.9
|
| Smiles |
Cl.NC(C(=O)O)C(O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1
|
Cl.NC(C(=O)O)C(O)c1ccc(OCc2ccccc2)c(OCc2ccccc2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.