| Name |
methyl 2-[1-(3-methoxyphenyl)-6,7-dimethyl-3,9-dioxo-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-2-yl]-4-methyl-1,3-thiazole-5-carboxylate
|
| Molecular Formula |
C26H28N2O6S
|
| Molecular Weight |
496.6
|
| Smiles |
COC(=O)c1sc(N2C(=O)C3=C(C(=O)C4CC(C)C(C)CC4O3)C2c2cccc(OC)c2)nc1C
|
COC(=O)c1sc(N2C(=O)C3=C(C(=O)C4CC(C)C(C)CC4O3)C2c2cccc(OC)c2)nc1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.