| Name |
1-(2-ethoxyethyl)-3,9-dimethyl-7-(naphthalen-1-ylmethyl)-5a,9a,10,10a-tetrahydro-4H-purino[8,7-c][1,2,4]triazine-6,8-dione
|
| Molecular Formula |
C24H30N6O3
|
| Molecular Weight |
450.5
|
| Smiles |
CCOCCN1N=C(C)CN2C3C(=O)N(Cc4cccc5ccccc45)C(=O)N(C)C3NC12
|
CCOCCN1N=C(C)CN2C3C(=O)N(Cc4cccc5ccccc45)C(=O)N(C)C3NC12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.