| Name |
2-{[(1-phenyl-1H-1,2,3,4-tetrazol-5-yl)sulfanyl]methyl}piperidine hydrochloride
|
| Molecular Formula |
C13H18ClN5S
|
| Molecular Weight |
311.83
|
| Smiles |
Cl.c1ccc(-n2nnnc2SCC2CCCCN2)cc1
|
Cl.c1ccc(-n2nnnc2SCC2CCCCN2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.