| Name |
2-{8-Oxatricyclo[7.4.0.0,2,7]trideca-1(9),2(7),3,5,10,12-hexaen-5-yl}-2-oxoacetic acid
|
| Molecular Formula |
C14H8O4
|
| Molecular Weight |
240.21
|
| Smiles |
O=C(O)C(=O)c1ccc2c(c1)oc1ccccc12
|
O=C(O)C(=O)c1ccc2c(c1)oc1ccccc12
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.