| Name |
5-[(2-Chlorophenyl)methyl]-8-(4-methoxyphenyl)-1,3-dimethyl-4a,9a-dihydropurino[8,9-c][1,2,4]triazole-2,4-dione
|
| Molecular Formula |
C22H21ClN6O3
|
| Molecular Weight |
452.9
|
| Smiles |
COc1ccc(-c2nnc3n2C2C(C(=O)N(C)C(=O)N2C)N3Cc2ccccc2Cl)cc1
|
COc1ccc(-c2nnc3n2C2C(C(=O)N(C)C(=O)N2C)N3Cc2ccccc2Cl)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.