| Name |
ethyl 2-{[3-(2-hydroxy-5-oxo-4,5-dihydro-3H-1,4-benzodiazepin-3-yl)propanoyl]amino}-1,3-thiazole-4-carboxylate
|
| Molecular Formula |
C18H18N4O5S
|
| Molecular Weight |
402.4
|
| Smiles |
CCOC(=O)c1csc(NC(=O)CCC2NC(=O)c3ccccc3NC2=O)n1
|
CCOC(=O)c1csc(NC(=O)CCC2NC(=O)c3ccccc3NC2=O)n1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.