| Name |
Benzamidine,n-(5-bromo-4,6-dimethyl-2-pyridinyl)-
|
| Molecular Formula |
C14H14BrN3
|
| Molecular Weight |
304.18
|
| Smiles |
Cc1cc(N=C(N)c2ccccc2)nc(C)c1Br
|
Cc1cc(N=C(N)c2ccccc2)nc(C)c1Br
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.