| Name |
3-[3-(pyridin-4-yl)-1,2,4-oxadiazol-5-yl]-1-(1,3,4,9-tetrahydro-2H-beta-carbolin-2-yl)propan-1-one
|
| Molecular Formula |
C21H19N5O2
|
| Molecular Weight |
373.4
|
| Smiles |
O=C(CCc1nc(-c2ccncc2)no1)N1CCc2c([nH]c3ccccc23)C1
|
O=C(CCc1nc(-c2ccncc2)no1)N1CCc2c([nH]c3ccccc23)C1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.