| Name |
Z-Thr(Bzl)-OH . DCHA
|
| Molecular Formula |
C31H44N2O5
|
| Molecular Weight |
524.7
|
| Smiles |
C1CCC(NC2CCCCC2)CC1.CC(OCc1ccccc1)C(NC(=O)OCc1ccccc1)C(=O)O
|
C1CCC(NC2CCCCC2)CC1.CC(OCc1ccccc1)C(NC(=O)OCc1ccccc1)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.