| Name |
4H-Thieno[3,2-c][1]benzothiopyran-2-carboxylic acid, 8-fluoro-, 2-propyn-1-yl ester
|
| Molecular Formula |
C15H9FO2S2
|
| Molecular Weight |
304.4
|
| Smiles |
C#CCOC(=O)c1cc2c(s1)-c1cc(F)ccc1SC2
|
C#CCOC(=O)c1cc2c(s1)-c1cc(F)ccc1SC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.