| Name |
2-Benzofurancarboxamide, 4,5,6,7-tetrahydro-3-methyl-N-[4-(2-phenyldiazenyl)phenyl]-4-[2-[3-(trifluoromethyl)phenyl]hydrazinylidene]-
|
| Molecular Formula |
C29H24F3N5O2
|
| Molecular Weight |
531.5
|
| Smiles |
Cc1c(C(=O)Nc2ccc(N=Nc3ccccc3)cc2)oc2c1C(=NNc1cccc(C(F)(F)F)c1)CCC2
|
Cc1c(C(=O)Nc2ccc(N=Nc3ccccc3)cc2)oc2c1C(=NNc1cccc(C(F)(F)F)c1)CCC2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.