| Name |
Benzamide, N-[4-[(7-chloro-2,3,4,5-tetrahydro-5-oxo-1H-1-benzazepin-1-yl)carbonyl]-3-methylphenyl]-4-methyl-
|
| Molecular Formula |
C26H23ClN2O3
|
| Molecular Weight |
446.9
|
| Smiles |
Cc1ccc(C(=O)Nc2ccc(C(=O)N3CCCC(=O)c4cc(Cl)ccc43)c(C)c2)cc1
|
Cc1ccc(C(=O)Nc2ccc(C(=O)N3CCCC(=O)c4cc(Cl)ccc43)c(C)c2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.