| Name |
4,4,5,5-Tetramethyl-2-[8-(trifluoromethyl)spiro[2,3-dihydrochromene-4,1'-cyclopropane]-6-yl]-1,3,2-dioxaborolane
|
| Molecular Formula |
C18H22BF3O3
|
| Molecular Weight |
354.2
|
| Smiles |
CC1(C)OB(c2cc(C(F)(F)F)c3c(c2)C2(CCO3)CC2)OC1(C)C
|
CC1(C)OB(c2cc(C(F)(F)F)c3c(c2)C2(CCO3)CC2)OC1(C)C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.