| Name |
ethyl 2-[8-(4-ethylphenyl)-1,7-dimethyl-2,4-dioxo-1H,2H,3H,4H,8H-imidazo[1,2-g]purin-3-yl]acetate
|
| Molecular Formula |
C21H25N5O4
|
| Molecular Weight |
411.5
|
| Smiles |
CCOC(=O)CN1C(=O)C2C(N=C3N(c4ccc(CC)cc4)C(C)=CN32)N(C)C1=O
|
CCOC(=O)CN1C(=O)C2C(N=C3N(c4ccc(CC)cc4)C(C)=CN32)N(C)C1=O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.