| Name |
Methyl 4-(3,9-dioxo-1,2,4a,5,6,7,8,8a-octahydrochromeno[2,3-c]pyrrol-1-yl)benzoate
|
| Molecular Formula |
C19H19NO5
|
| Molecular Weight |
341.4
|
| Smiles |
COC(=O)c1ccc(C2NC(=O)C3=C2C(=O)C2CCCCC2O3)cc1
|
COC(=O)c1ccc(C2NC(=O)C3=C2C(=O)C2CCCCC2O3)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.