| Name |
methyl 4-[3,9-dioxo-2-(pyridin-4-ylmethyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrol-1-yl]benzoate
|
| Molecular Formula |
C25H24N2O5
|
| Molecular Weight |
432.5
|
| Smiles |
COC(=O)c1ccc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2Cc2ccncc2)cc1
|
COC(=O)c1ccc(C2C3=C(OC4CCCCC4C3=O)C(=O)N2Cc2ccncc2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.