| Name |
(2E,4E,6E,8E)-deca-2,4,6,8-tetraenedioic acid sodium salt
|
| Molecular Formula |
C10H8Na2O4
|
| Molecular Weight |
238.15
|
| Smiles |
O=C([O-])C=CC=CC=CC=CC(=O)[O-].[Na+].[Na+]
|
O=C([O-])C=CC=CC=CC=CC(=O)[O-].[Na+].[Na+]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.