| Name |
1,2,4,5-Tetrazine, 3,3a(2)-azobis[6-phenyl-
|
| Molecular Formula |
C16H10N10
|
| Molecular Weight |
342.32
|
| Smiles |
c1ccc(-c2nnc(N=Nc3nnc(-c4ccccc4)nn3)nn2)cc1
|
c1ccc(-c2nnc(N=Nc3nnc(-c4ccccc4)nn3)nn2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.