| Name |
L-Glutaminyl-L-lysyl-N~5~-(diaminomethylidene)-L-ornithyl-L-prolyl-L-seryl-L-glutaminyl-N~5~-(diaminomethylidene)-L-ornithine
|
| Molecular Formula |
C36H66N16O11
|
| Molecular Weight |
899.0
|
| Smiles |
NCCCCC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(CO)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O
|
NCCCCC(NC(=O)C(N)CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)N1CCCC1C(=O)NC(CO)C(=O)NC(CCC(N)=O)C(=O)NC(CCCN=C(N)N)C(=O)O
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.