| Name |
(7-(2-Chlorophenyl)-1,4-thiazepan-4-yl)(2,3,4-trifluorophenyl)methanone
|
| Molecular Formula |
C18H15ClF3NOS
|
| Molecular Weight |
385.8
|
| Smiles |
O=C(c1ccc(F)c(F)c1F)N1CCSC(c2ccccc2Cl)CC1
|
O=C(c1ccc(F)c(F)c1F)N1CCSC(c2ccccc2Cl)CC1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.