| Name |
2-(furan-2-ylmethyl)-6,7-dimethyl-1-(3,4,5-trimethoxyphenyl)-4a,5,6,7,8,8a-hexahydro-1H-chromeno[2,3-c]pyrrole-3,9-dione
|
| Molecular Formula |
C27H31NO7
|
| Molecular Weight |
481.5
|
| Smiles |
COc1cc(C2C3=C(OC4CC(C)C(C)CC4C3=O)C(=O)N2Cc2ccco2)cc(OC)c1OC
|
COc1cc(C2C3=C(OC4CC(C)C(C)CC4C3=O)C(=O)N2Cc2ccco2)cc(OC)c1OC
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.