| Name |
3-(2-oxo-2-phenylethyl)-4H,5H,6H,7H,8H-cyclohepta[d][1,3]thiazol-3-ium bromide
|
| Molecular Formula |
C16H18BrNOS
|
| Molecular Weight |
352.3
|
| Smiles |
O=C(C[n+]1csc2c1CCCCC2)c1ccccc1.[Br-]
|
O=C(C[n+]1csc2c1CCCCC2)c1ccccc1.[Br-]
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.