| Name |
N-cyano-3-ethyl-N-{[2-(methoxymethyl)-1,3-thiazol-4-yl]methyl}aniline
|
| Molecular Formula |
C15H17N3OS
|
| Molecular Weight |
287.4
|
| Smiles |
CCc1cccc(N(C#N)Cc2csc(COC)n2)c1
|
CCc1cccc(N(C#N)Cc2csc(COC)n2)c1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.