| Name |
1-(4,6-dimethylpyrimidin-2-yl)-N-{3-[5-(methoxymethyl)-1H-1,2,4-triazol-3-yl]phenyl}piperidine-4-carboxamide
|
| Molecular Formula |
C22H27N7O2
|
| Molecular Weight |
421.5
|
| Smiles |
COCc1nc(-c2cccc(NC(=O)C3CCN(c4nc(C)cc(C)n4)CC3)c2)n[nH]1
|
COCc1nc(-c2cccc(NC(=O)C3CCN(c4nc(C)cc(C)n4)CC3)c2)n[nH]1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.