| Name |
4-(8-chloro-2,3-dihydro-1,4-benzodioxin-6-yl)-N-(cyanomethyl)-1H-pyrrole-3-carboxamide
|
| Molecular Formula |
C15H12ClN3O3
|
| Molecular Weight |
317.72
|
| Smiles |
N#CCNC(=O)c1c[nH]cc1-c1cc(Cl)c2c(c1)OCCO2
|
N#CCNC(=O)c1c[nH]cc1-c1cc(Cl)c2c(c1)OCCO2
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.